| 1 | 2,3,5,6-TETRACHLOROPHENOL |
| 2 | Phenol, 2,3,5,6-tetrachloro- |
| 3 | 2,3,5,6-Tetrachlorophenate |
| 4 | SW5F2W8SDJ |
| 5 | 2,3,5,6-Tetrachloro phenol |
2,3,5,6-tetrachlorophenol is the 2,3,5,6-isomer of tetrachlorophenol It is a conjugate acid of a 2,3,5,6-tetrachlorophenolate.
| Molecular Formula | C6H2Cl4O |
|---|---|
| Canonical SMILES | C1=C(C(=C(C(=C1Cl)Cl)O)Cl)Cl |
| Isomeric SMILES | C1=C(C(=C(C(=C1Cl)Cl)O)Cl)Cl |
| Molecular Weight | 231.9000 |
| InChIKey | KEWNKZNZRIAIAK-UHFFFAOYSA-N |
| InChI | InChI=1S/C6H2Cl4O/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H |
| XLogP | 3.9000 |
| ExactMass | 231.8830 |
| MonoisotopicMass | 229.8860 |
| TPSA | 20.2000 |
| Complexity | 129.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 1 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 11 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 499 |
| PatentFamilyCount | 228 |
| LiteratureCount | 295 |