4-Aminoacetanilide
CAS: 122-80-5
| 1 | 4-AMINOACETANILIDE |
| 2 | p-Amino acetanilide |
| 3 | DTXSID7024455 |
| 4 | DTXCID704455 |
| 5 | RefChem:857977 |
4'-aminoacetanilide is an acetamide that is 1,4-phenylenediamine in which the the amino group at position 4 is replaced by an acetylamino group. It has a role as a human xenobiotic metabolite, a bacterial xenobiotic metabolite and a human urinary metabolite. It is a member of acetamides and a substituted aniline. It is functionally related to a 1,4-phenylenediamine.
| Molecular Formula | C8H10N2O |
|---|---|
| Canonical SMILES | |
| Isomeric SMILES | |
| Molecular Weight | 150.1800 |
| InChIKey | CHMBIJAOCISYEW-UHFFFAOYSA-N |
| InChI | InChI=1S/C8H10N2O/c1-6(11)10-8-4-2-7(9)3-5-8/h2-5H,9H2,1H3,(H,10,11) |
| XLogP | 0.1000 |
| ExactMass | 150.0793 |
| MonoisotopicMass | 150.0793 |
| TPSA | 55.1000 |
| Complexity | 139.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 1 |
| HeavyAtomCount | 11 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 5931 |
| PatentFamilyCount | 2626 |
| LiteratureCount | 170 |