Isopentenyladenine
CAS: 2365-40-4
| 1 | Isopentenyladenine |
| 2 | 6-(gamma,gamma-Dimethylallylamino)purine |
| 3 | Isopentenyl adenine |
| 4 | IPADE |
| 5 | Dimethylallyladenine |
N(6)-dimethylallyladenine is a 6-isopentenylaminopurine in which has the isopentenyl double bond is located between the 2 and 3 positions of the isopentenyl group. It has a role as a cytokinin.
| Molecular Formula | C10H13N5 |
|---|---|
| Canonical SMILES | |
| Isomeric SMILES | |
| Molecular Weight | 203.2400 |
| InChIKey | HYVABZIGRDEKCD-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H13N5/c1-7(2)3-4-11-9-8-10(13-5-12-8)15-6-14-9/h3,5-6H,4H2,1-2H3,(H2,11,12,13,14,15) |
| XLogP | 2.1000 |
| ExactMass | 203.1171 |
| MonoisotopicMass | 203.1171 |
| TPSA | 66.5000 |
| Complexity | 236.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 15 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 18780 |
| PatentFamilyCount | 5955 |
| LiteratureCount | 556 |