Carbamide Peroxide
CAS: 124-43-6
| 1 | Urea hydrogen peroxide |
| 2 | CARBAMIDE PEROXIDE |
| 3 | Percarbamide |
| 4 | Urea peroxide |
| 5 | Urea dioxide |
Urea hydrogen peroxide is a mixture obtained by combining equimolar amounts of hydrogen peroxide and urea. It has a role as a reagent, a disinfectant and an oxidising agent. It contains a urea and a hydrogen peroxide.
| Molecular Formula | CH6N2O3 |
|---|---|
| Canonical SMILES | |
| Isomeric SMILES | |
| Molecular Weight | 94.0700 |
| InChIKey | AQLJVWUFPCUVLO-UHFFFAOYSA-N |
| InChI | InChI=1S/CH4N2O.H2O2/c2-1(3)4;1-2/h(H4,2,3,4);1-2H |
| XLogP | 0.0000 |
| ExactMass | 94.0378 |
| MonoisotopicMass | 94.0378 |
| TPSA | 110.0000 |
| Complexity | 29.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 4 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 6 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 50790 |
| PatentFamilyCount | 16045 |
| LiteratureCount | 1930 |