Diethyl hydrogen phosphite
CAS: 762-04-9
| 1 | Diethyl phosphite |
| 2 | Diethyl phosphonate |
| 3 | Diethoxyphosphine oxide |
| 4 | Phosphonic acid diethyl ester |
| 5 | Phosphonic acid, diethyl ester |
Diethyl phosphonate is a phosphonic ester that is the diethyl ester of phosphonic acid.
| Molecular Formula | C4H10O3P+ |
|---|---|
| Canonical SMILES | |
| Isomeric SMILES | |
| Molecular Weight | 137.0900 |
| InChIKey | LXCYSACZTOKNNS-UHFFFAOYSA-N |
| InChI | InChI=1S/C4H10O3P/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3/q+1 |
| XLogP | 0.7000 |
| ExactMass | 137.0368 |
| MonoisotopicMass | 137.0368 |
| TPSA | 35.5000 |
| Complexity | 65.0000 |
| Charge | 1.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 4 |
| HeavyAtomCount | 8 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 24976 |
| PatentFamilyCount | 10652 |
| LiteratureCount | 518 |