Acrylamide
CAS: 91079-40-2
| 1 | ACRYLAMIDE |
| 2 | 2-Propenamide |
| 3 | prop-2-enamide |
| 4 | Propenamide |
| 5 | Acrylic acid amide |
Acrylamide can cause cancer according to The World Health Organization's International Agency for Research on Cancer (IARC) and The Environmental Protection Agency (EPA). It can cause developmental toxicity and male reproductive toxicity according to The National Toxicology Program's Center for the Evaluation of Risks to Human Reproduction.
| Molecular Formula | C3H5NO |
|---|---|
| Canonical SMILES | |
| Isomeric SMILES | |
| Molecular Weight | 71.0800 |
| InChIKey | HRPVXLWXLXDGHG-UHFFFAOYSA-N |
| InChI | InChI=1S/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5) |
| XLogP | -0.7000 |
| ExactMass | 71.0371 |
| MonoisotopicMass | 71.0371 |
| TPSA | 43.1000 |
| Complexity | 57.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 1 |
| RotatableBondCount | 1 |
| HeavyAtomCount | 5 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 285387 |
| PatentFamilyCount | 147769 |
| LiteratureCount | 42892 |