Acrylic Acid
CAS: 79-10-7
| 1 | ACRYLIC ACID |
| 2 | 2-Propenoic acid |
| 3 | prop-2-enoic acid |
| 4 | Propenoic acid |
| 5 | Vinylformic acid |
Acrylic acid is a alpha,beta-unsaturated monocarboxylic acid that is ethene substituted by a carboxy group. It has a role as a metabolite. It is a conjugate acid of an acrylate.
| Molecular Formula | C3H4O2 |
|---|---|
| Canonical SMILES | |
| Isomeric SMILES | |
| Molecular Weight | 72.0600 |
| InChIKey | NIXOWILDQLNWCW-UHFFFAOYSA-N |
| InChI | InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) |
| XLogP | 0.3000 |
| ExactMass | 72.0211 |
| MonoisotopicMass | 72.0211 |
| TPSA | 37.3000 |
| Complexity | 55.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 1 |
| HeavyAtomCount | 5 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 974512 |
| PatentFamilyCount | 516236 |
| LiteratureCount | 15280 |