| 1 | glycine |
| 2 | 2-Aminoacetic acid |
| 3 | aminoacetic acid |
| 4 | Glycocoll |
| 5 | Aminoethanoic acid |
Glycine is the simplest (and the only achiral) proteinogenic amino acid, with a hydrogen atom as its side chain. It has a role as a nutraceutical, a hepatoprotective agent, an EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor, a NMDA receptor agonist, a micronutrient, a fundamental metabolite and a neurotransmitter. It is an alpha-amino acid, a serine family amino acid and a proteinogenic amino acid. It is a conjugate base of a glycinium. It is a conjugate acid of a glycinate. It is a tautomer of a glycine zwitterion.
| Molecular Formula | C2H5NO2 |
|---|---|
| Canonical SMILES | C(C(=O)O)N |
| Isomeric SMILES | C(C(=O)O)N |
| Molecular Weight | 75.0700 |
| InChIKey | DHMQDGOQFOQNFH-UHFFFAOYSA-N |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) |
| XLogP | -3.2000 |
| ExactMass | 75.0320 |
| MonoisotopicMass | 75.0320 |
| TPSA | 63.3000 |
| Complexity | 42.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 1 |
| HeavyAtomCount | 5 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 88671 |
| PatentFamilyCount | 39119 |
| LiteratureCount | 124182 |