D-phenylalanine
CAS: 673-06-3
| 1 | D-phenylalanine |
| 2 | H-D-Phe-OH |
| 3 | (2R)-2-amino-3-phenylpropanoic acid |
| 4 | Phenylalanine D-form |
| 5 | Sabiden |
D-phenylalanine is the D-enantiomer of phenylalanine. It is a phenylalanine and a D-alpha-amino acid. It is a conjugate base of a D-phenylalaninium. It is a conjugate acid of a D-phenylalaninate. It is an enantiomer of a L-phenylalanine. It is a tautomer of a D-phenylalanine zwitterion.
| Molecular Formula | C9H11NO2 |
|---|---|
| Canonical SMILES | C1=CC=C(C=C1)CC(C(=O)O)N |
| Isomeric SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)N |
| Molecular Weight | 165.1900 |
| InChIKey | COLNVLDHVKWLRT-MRVPVSSYSA-N |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m1/s1 |
| XLogP | -1.5000 |
| ExactMass | 165.0790 |
| MonoisotopicMass | 165.0790 |
| TPSA | 63.3000 |
| Complexity | 153.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 12 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 1 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 20304 |
| PatentFamilyCount | 6283 |
| LiteratureCount | 1693 |