D-Tryptophan
CAS: 153-94-6
| 1 | D-Tryptophan |
| 2 | H-D-Trp-OH |
| 3 | (R)-Tryptophan |
| 4 | D-TRYPTOPHANE |
| 5 | D(+)-Tryptophan |
D-tryptophan is the D-enantiomer of tryptophan. It has a role as a bacterial metabolite. It is a tryptophan and a D-alpha-amino acid. It is a conjugate base of a D-tryptophanium. It is a conjugate acid of a D-tryptophanate. It is an enantiomer of a L-tryptophan. It is a tautomer of a D-tryptophan zwitterion.
| Molecular Formula | C11H12N2O2 |
|---|---|
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N |
| Isomeric SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@H](C(=O)O)N |
| Molecular Weight | 204.2200 |
| InChIKey | QIVBCDIJIAJPQS-SECBINFHSA-N |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m1/s1 |
| XLogP | -1.1000 |
| ExactMass | 204.0899 |
| MonoisotopicMass | 204.0899 |
| TPSA | 79.1000 |
| Complexity | 245.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 3 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 15 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 1 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 37210 |
| PatentFamilyCount | 14589 |
| LiteratureCount | 1338 |