1-Propene, 2-methyl-
CAS: 115-11-7
| 1 | ISOBUTYLENE |
| 2 | Isobutene |
| 3 | 2-methylprop-1-ene |
| 4 | 2-Methylpropene |
| 5 | 2-Methyl-1-propene |
2-methylprop-1-ene is an alkene that is prop-1-ene substituted by a methyl group at position 2. It is an alkene and a gas molecular entity.
| Molecular Formula | C4H8 |
|---|---|
| Canonical SMILES | CC(=C)C |
| Isomeric SMILES | CC(=C)C |
| Molecular Weight | 56.1100 |
| InChIKey | VQTUBCCKSQIDNK-UHFFFAOYSA-N |
| InChI | InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3 |
| XLogP | 2.1000 |
| ExactMass | 56.0626 |
| MonoisotopicMass | 56.0626 |
| TPSA | 0.0000 |
| Complexity | 23.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 0 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 4 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 105133 |
| PatentFamilyCount | 42388 |
| LiteratureCount | 5814 |