| 1 | N-NITROSO-N-METHYLURETHANE |
| 2 | N-Methyl-N-nitrosourethane |
| 3 | Methylnitrosourethane |
| 4 | Nitrosomethylurethane |
| 5 | Ethyl N-Methyl-N-nitrosocarbamate |
N-Nitroso-N-methylurethane can cause cancer according to an independent committee of scientific and health experts.
| Molecular Formula | C4H8N2O3 |
|---|---|
| Canonical SMILES | CCOC(=O)N(C)N=O |
| Isomeric SMILES | CCOC(=O)N(C)N=O |
| Molecular Weight | 132.1200 |
| InChIKey | CAUBWLYZCDDYEF-UHFFFAOYSA-N |
| InChI | InChI=1S/C4H8N2O3/c1-3-9-4(7)6(2)5-8/h3H2,1-2H3 |
| XLogP | 0.2000 |
| ExactMass | 132.0535 |
| MonoisotopicMass | 132.0535 |
| TPSA | 59.0000 |
| Complexity | 114.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 2 |
| HeavyAtomCount | 9 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 679 |
| PatentFamilyCount | 245 |
| LiteratureCount | 431 |