Nabam
CAS: 142-59-6
| 1 | nabam |
| 2 | Spring-Bak |
| 3 | Parzate |
| 4 | Dithane A-40 |
| 5 | Nabame |
Nabam is a dithiocarbamate salt that is the disodium salt of ethylenebis(dithiocarbamic acid). A fungicide, algicide and bactericide used on various crops including on cotton, capsicums, onions and rice crops, it is considered to be a carcinogen, so is not licensed for use within the European Union. Mixing nabam with zinc sulfate affords the fungicide zineb. It has a role as an antifungal agrochemical. It is a dithiocarbamate salt and an organic sodium salt. It contains an ethylenebis(dithiocarbamate).
| Molecular Formula | C4H6N2Na2S4 |
|---|---|
| Canonical SMILES | C(CNC(=S)[S-])NC(=S)[S-].[Na+].[Na+] |
| Isomeric SMILES | C(CNC(=S)[S-])NC(=S)[S-].[Na+].[Na+] |
| Molecular Weight | 256.4000 |
| InChIKey | UQJQVUOTMVCFHX-UHFFFAOYSA-L |
| InChI | InChI=1S/C4H8N2S4.2Na/c7-3(8)5-1-2-6-4(9)10;;/h1-2H2,(H2,5,7,8)(H2,6,9,10);;/q;2*+1/p-2 |
| XLogP | 0.0000 |
| ExactMass | 255.9209 |
| MonoisotopicMass | 255.9209 |
| TPSA | 90.2000 |
| Complexity | 108.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 12 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 3 |
| PatentCount | 8952 |
| PatentFamilyCount | 2467 |
| LiteratureCount | 38 |