Mevinphos
CAS: 7786-34-7
| 1 | mevinphos |
| 2 | cis-Mevinphos |
| 3 | Phosdrin |
| 4 | cis-Phosdrin |
| 5 | (E)-Mevinphos |
Mevinphos is a dialkyl phosphate and an organophosphate insecticide. It has a role as an EC 3.1.1.7 (acetylcholinesterase) inhibitor, an acaricide, an agrochemical and an avicide. It is functionally related to a methyl 3-hydroxybut-2-enoate.
| Molecular Formula | C7H13O6P |
|---|---|
| Canonical SMILES | CC(=CC(=O)OC)OP(=O)(OC)OC |
| Isomeric SMILES | C/C(=C\C(=O)OC)/OP(=O)(OC)OC |
| Molecular Weight | 224.1500 |
| InChIKey | GEPDYQSQVLXLEU-AATRIKPKSA-N |
| InChI | InChI=1S/C7H13O6P/c1-6(5-7(8)10-2)13-14(9,11-3)12-4/h5H,1-4H3/b6-5+ |
| XLogP | 1.2000 |
| ExactMass | 224.0450 |
| MonoisotopicMass | 224.0450 |
| TPSA | 71.1000 |
| Complexity | 263.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 6 |
| RotatableBondCount | 6 |
| HeavyAtomCount | 14 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 1 |
| DefinedBondStereoCount | 1 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 24293 |
| PatentFamilyCount | 5303 |
| LiteratureCount | 1882 |