Metiram
CAS: 9006-42-2
| 1 | ZINEB |
| 2 | METIRAM |
| 3 | 12122-67-7 |
| 4 | Zinc ethylenebisthiocarbamate |
| 5 | NIA 9102 |
Metiram can cause cancer and developmental toxicity according to The Environmental Protection Agency (EPA).
| Molecular Formula | C4H6N2S4Zn |
|---|---|
| Canonical SMILES | C(CNC(=S)[S-])NC(=S)[S-].[Zn+2] |
| Isomeric SMILES | C(CNC(=S)[S-])NC(=S)[S-].[Zn+2] |
| Molecular Weight | 275.8000 |
| InChIKey | AMHNZOICSMBGDH-UHFFFAOYSA-L |
| InChI | InChI=1S/C4H8N2S4.Zn/c7-3(8)5-1-2-6-4(9)10;/h1-2H2,(H2,5,7,8)(H2,6,9,10);/q;+2/p-2 |
| XLogP | 0.0000 |
| ExactMass | 273.8705 |
| MonoisotopicMass | 273.8705 |
| TPSA | 90.2000 |
| Complexity | 108.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 11 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 12897 |
| PatentFamilyCount | 7463 |
| LiteratureCount | 154 |