Mecoprop
CAS: 93-65-2
| 1 | MECOPROP |
| 2 | 2-(4-Chloro-2-methylphenoxy)propanoic acid |
| 3 | Compitox |
| 4 | Mecopeop |
| 5 | 7085-19-0 |
2-(4-chloro-2-methylphenoxy)propanoic acid is a monocarboxylic acid that is lactic acid in which the hydroxyl hydrogen is replaced by a 4-chloro-2-methylphenyl group. It is an aromatic ether, a monocarboxylic acid and a member of monochlorobenzenes. It is functionally related to a rac-lactic acid.
| Molecular Formula | C10H11ClO3 |
|---|---|
| Canonical SMILES | CC1=C(C=CC(=C1)Cl)OC(C)C(=O)O |
| Isomeric SMILES | CC1=C(C=CC(=C1)Cl)OC(C)C(=O)O |
| Molecular Weight | 214.6400 |
| InChIKey | WNTGYJSOUMFZEP-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13) |
| XLogP | 3.1000 |
| ExactMass | 214.0397 |
| MonoisotopicMass | 214.0397 |
| TPSA | 46.5000 |
| Complexity | 208.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 14 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 1 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 32217 |
| PatentFamilyCount | 7608 |
| LiteratureCount | 1184 |