| 1 | hydroquinone |
| 2 | Benzene-1,4-diol |
| 3 | 1,4-benzenediol |
| 4 | Quinol |
| 5 | 1,4-Dihydroxybenzene |
Hydroquinone is a benzenediol comprising benzene core carrying two hydroxy substituents para to each other. It has a role as a cofactor, a carcinogenic agent, an Escherichia coli metabolite, a human xenobiotic metabolite, a skin lightening agent, an antioxidant and a mouse metabolite. It is a benzenediol and a member of hydroquinones.
| Molecular Formula | C6H6O2 |
|---|---|
| Canonical SMILES | C1=CC(=CC=C1O)O |
| Isomeric SMILES | C1=CC(=CC=C1O)O |
| Molecular Weight | 110.1100 |
| InChIKey | QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
| InChI | InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H |
| XLogP | 0.6000 |
| ExactMass | 110.0368 |
| MonoisotopicMass | 110.0368 |
| TPSA | 40.5000 |
| Complexity | 54.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 8 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 189286 |
| PatentFamilyCount | 80150 |
| LiteratureCount | 22079 |