Fluorene
CAS: 86-73-7
| 1 | FLUORENE |
| 2 | 9H-Fluorene |
| 3 | Diphenylenemethane |
| 4 | o-Biphenylenemethane |
| 5 | 2,3-Benzindene |
Fluorene is an ortho-fused tricyclic hydrocarbon that is a major component of fossil fuels and their derivatives It is an ortho-fused polycyclic arene and an ortho-fused tricyclic hydrocarbon.
| Molecular Formula | C13H10 |
|---|---|
| Canonical SMILES | C1C2=CC=CC=C2C3=CC=CC=C31 |
| Isomeric SMILES | C1C2=CC=CC=C2C3=CC=CC=C31 |
| Molecular Weight | 166.2200 |
| InChIKey | NIHNNTQXNPWCJQ-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2 |
| XLogP | 4.2000 |
| ExactMass | 166.0783 |
| MonoisotopicMass | 166.0783 |
| TPSA | 0.0000 |
| Complexity | 165.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 0 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 13 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 99089 |
| PatentFamilyCount | 40852 |
| LiteratureCount | 8025 |