| 1 | FENSULFOTHION |
| 2 | Dasanit |
| 3 | Daconit |
| 4 | Terracur P |
| 5 | Bayer 25141 |
Fensulfothion is an organic thiophosphate, a sulfoxide and an organothiophosphate insecticide. It has a role as an EC 3.1.1.7 (acetylcholinesterase) inhibitor, an agrochemical, an avicide and a nematicide. It is functionally related to a 4-(methylsulfinyl)phenol.
| Molecular Formula | C11H17O4PS2 |
|---|---|
| Canonical SMILES | CCOP(=S)(OCC)OC1=CC=C(C=C1)S(=O)C |
| Isomeric SMILES | CCOP(=S)(OCC)OC1=CC=C(C=C1)S(=O)C |
| Molecular Weight | 308.4000 |
| InChIKey | XDNBJTQLKCIJBV-UHFFFAOYSA-N |
| InChI | InChI=1S/C11H17O4PS2/c1-4-13-16(17,14-5-2)15-10-6-8-11(9-7-10)18(3)12/h6-9H,4-5H2,1-3H3 |
| XLogP | 2.2000 |
| ExactMass | 308.0306 |
| MonoisotopicMass | 308.0306 |
| TPSA | 96.1000 |
| Complexity | 306.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 6 |
| RotatableBondCount | 7 |
| HeavyAtomCount | 18 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 1 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 12201 |
| PatentFamilyCount | 2787 |
| LiteratureCount | 385 |