Famphur
CAS: 52-85-7
| 1 | Famphur |
| 2 | FAMOPHOS |
| 3 | Famofos |
| 4 | Warbex |
| 5 | Famphos |
Famphur is an organic thiophosphate and an organothiophosphate insecticide. It has a role as an EC 3.1.1.7 (acetylcholinesterase) inhibitor, an agrochemical and an anthelminthic drug. It is functionally related to a 4-hydroxy-N,N-dimethylbenzenesulfonamide.
| Molecular Formula | C10H16NO5PS2 |
|---|---|
| Canonical SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)OP(=S)(OC)OC |
| Isomeric SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)OP(=S)(OC)OC |
| Molecular Weight | 325.3000 |
| InChIKey | JISACBWYRJHSMG-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H16NO5PS2/c1-11(2)19(12,13)10-7-5-9(6-8-10)16-17(18,14-3)15-4/h5-8H,1-4H3 |
| XLogP | 2.2000 |
| ExactMass | 325.0208 |
| MonoisotopicMass | 325.0208 |
| TPSA | 106.0000 |
| Complexity | 418.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 7 |
| RotatableBondCount | 6 |
| HeavyAtomCount | 19 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 14307 |
| PatentFamilyCount | 3003 |
| LiteratureCount | 173 |