| 1 | Dichlorprop |
| 2 | 2-(2,4-Dichlorophenoxy)propanoic acid |
| 3 | 2-(2,4-Dichlorophenoxy)propionic acid |
| 4 | DICHLOROPROP |
| 5 | Hormatox |
2-(2,4-dichlorophenoxy)propanoic acid is an aromatic ether that is 2-hydroxypropanoic acid in which the hydroxy group at position 2 has been converted to its 2,4-dichlorophenyl ether. It is a monocarboxylic acid, an aromatic ether and a dichlorobenzene.
| Molecular Formula | C9H8Cl2O3 |
|---|---|
| Canonical SMILES | CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl |
| Isomeric SMILES | CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl |
| Molecular Weight | 235.0600 |
| InChIKey | MZHCENGPTKEIGP-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13) |
| XLogP | 3.4000 |
| ExactMass | 233.9850 |
| MonoisotopicMass | 233.9850 |
| TPSA | 46.5000 |
| Complexity | 210.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 14 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 1 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 25272 |
| PatentFamilyCount | 5684 |
| LiteratureCount | 791 |