| 1 | 1,4-Dinitrobenzene |
| 2 | P-DINITROBENZENE |
| 3 | Benzene, 1,4-dinitro- |
| 4 | Benzene, p-dinitro- |
| 5 | Dithane A-4 |
p-Dinitrobenzene can cause male reproductive toxicity according to The Environmental Protection Agency (EPA).
| Molecular Formula | C6H4N2O4 |
|---|---|
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])[N+](=O)[O-] |
| Isomeric SMILES | C1=CC(=CC=C1[N+](=O)[O-])[N+](=O)[O-] |
| Molecular Weight | 168.1100 |
| InChIKey | FYFDQJRXFWGIBS-UHFFFAOYSA-N |
| InChI | InChI=1S/C6H4N2O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H |
| XLogP | 1.5000 |
| ExactMass | 168.0171 |
| MonoisotopicMass | 168.0171 |
| TPSA | 91.6000 |
| Complexity | 165.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 12 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 7438 |
| PatentFamilyCount | 3246 |
| LiteratureCount | 681 |