| 1 | 2,6-DICHLOROPHENOL |
| 2 | Phenol, 2,6-dichloro- |
| 3 | 2,6-Dichlorfenol |
| 4 | RCRA waste number U082 |
| 5 | 2,6-dichloro-phenol |
2,6-dichlorophenol is a dichlorophenol with the chloro substituents at positions 2 and 6.
| Molecular Formula | C6H4Cl2O |
|---|---|
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)O)Cl |
| Isomeric SMILES | C1=CC(=C(C(=C1)Cl)O)Cl |
| Molecular Weight | 163.0000 |
| InChIKey | HOLHYSJJBXSLMV-UHFFFAOYSA-N |
| InChI | InChI=1S/C6H4Cl2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H |
| XLogP | 2.7000 |
| ExactMass | 161.9639 |
| MonoisotopicMass | 161.9639 |
| TPSA | 20.2000 |
| Complexity | 87.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 1 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 9 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 5304 |
| PatentFamilyCount | 2335 |
| LiteratureCount | 790 |