| 1 | diazinon |
| 2 | Dimpylate |
| 3 | Diazinone |
| 4 | Oleodiazinon |
| 5 | Ciazinon |
Diazinon is a member of the class of pyrimidines that is pyrimidine carrying an isopropyl group at position 2, a methyl group at position 6 and a (diethoxyphosphorothioyl)oxy group at position 4. It has a role as an agrochemical, an acaricide, an EC 3.1.1.8 (cholinesterase) inhibitor, a nematicide, an EC 3.1.1.7 (acetylcholinesterase) inhibitor, a xenobiotic and an environmental contaminant. It is an organic thiophosphate and a member of pyrimidines. It is functionally related to a 2-isopropyl-6-methylpyrimidin-4-ol.
| Molecular Formula | C12H21N2O3PS |
|---|---|
| Canonical SMILES | CCOP(=S)(OCC)OC1=NC(=NC(=C1)C)C(C)C |
| Isomeric SMILES | CCOP(=S)(OCC)OC1=NC(=NC(=C1)C)C(C)C |
| Molecular Weight | 304.3500 |
| InChIKey | FHIVAFMUCKRCQO-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H21N2O3PS/c1-6-15-18(19,16-7-2)17-11-8-10(5)13-12(14-11)9(3)4/h8-9H,6-7H2,1-5H3 |
| XLogP | 3.8000 |
| ExactMass | 304.1011 |
| MonoisotopicMass | 304.1011 |
| TPSA | 85.6000 |
| Complexity | 307.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 6 |
| RotatableBondCount | 7 |
| HeavyAtomCount | 19 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 66874 |
| PatentFamilyCount | 20148 |
| LiteratureCount | 5921 |