Cyfluthrin
CAS: 68359-37-5
| 1 | CYFLUTHRIN |
| 2 | Cyfoxylate |
| 3 | Baythroid |
| 4 | Responsar |
| 5 | Syfrutrin |
Cyfluthrin is a carboxylic ester obtained by formal condensation between 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylic acid and (4-fluoro-3-phenoxyphenyl)(hydroxy)acetonitrile. It has a role as a pyrethroid ester insecticide and an agrochemical. It is an organochlorine compound, an organofluorine compound, a nitrile, an aromatic ether and a cyclopropanecarboxylate ester. It is functionally related to a 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid.
| Molecular Formula | C22H18Cl2FNO3 |
|---|---|
| Canonical SMILES | CC1(C(C1C(=O)OC(C#N)C2=CC(=C(C=C2)F)OC3=CC=CC=C3)C=C(Cl)Cl)C |
| Isomeric SMILES | CC1(C(C1C(=O)OC(C#N)C2=CC(=C(C=C2)F)OC3=CC=CC=C3)C=C(Cl)Cl)C |
| Molecular Weight | 434.3000 |
| InChIKey | QQODLKZGRKWIFG-UHFFFAOYSA-N |
| InChI | InChI=1S/C22H18Cl2FNO3/c1-22(2)15(11-19(23)24)20(22)21(27)29-18(12-26)13-8-9-16(25)17(10-13)28-14-6-4-3-5-7-14/h3-11,15,18,20H,1-2H3 |
| XLogP | 6.2000 |
| ExactMass | 433.0648 |
| MonoisotopicMass | 433.0648 |
| TPSA | 59.3000 |
| Complexity | 679.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 5 |
| RotatableBondCount | 7 |
| HeavyAtomCount | 29 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 3 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 3 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 33510 |
| PatentFamilyCount | 7937 |
| LiteratureCount | 1392 |