C.I. Solvent Yellow 3
CAS: 97-56-3
| 1 | o-Aminoazotoluene |
| 2 | Solvent Yellow 3 |
| 3 | Fast Garnet GBC Base |
| 4 | 2-Aminoazotoluene |
| 5 | C.I. Solvent Yellow 3 |
o-Aminoazotoluene can cause cancer according to an independent committee of scientific and health experts.
| Molecular Formula | C14H15N3 |
|---|---|
| Canonical SMILES | CC1=CC=CC=C1N=NC2=CC(=C(C=C2)N)C |
| Isomeric SMILES | CC1=CC=CC=C1N=NC2=CC(=C(C=C2)N)C |
| Molecular Weight | 225.2900 |
| InChIKey | PFRYFZZSECNQOL-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H15N3/c1-10-5-3-4-6-14(10)17-16-12-7-8-13(15)11(2)9-12/h3-9H,15H2,1-2H3 |
| XLogP | 3.7000 |
| ExactMass | 225.1266 |
| MonoisotopicMass | 225.1266 |
| TPSA | 50.7000 |
| Complexity | 264.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 2 |
| HeavyAtomCount | 17 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 1341 |
| PatentFamilyCount | 892 |
| LiteratureCount | 315 |