Chlorpyrifos
CAS: 2921-88-2
| 1 | chlorpyrifos |
| 2 | Dursban |
| 3 | Chlorpyriphos |
| 4 | Lorsban |
| 5 | Trichlorpyrphos |
Chlorpyrifos can cause developmental toxicity according to an independent committee of scientific and health experts.
| Molecular Formula | C9H11Cl3NO3PS |
|---|---|
| Canonical SMILES | CCOP(=S)(OCC)OC1=NC(=C(C=C1Cl)Cl)Cl |
| Isomeric SMILES | CCOP(=S)(OCC)OC1=NC(=C(C=C1Cl)Cl)Cl |
| Molecular Weight | 350.6000 |
| InChIKey | SBPBAQFWLVIOKP-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H11Cl3NO3PS/c1-3-14-17(18,15-4-2)16-9-7(11)5-6(10)8(12)13-9/h5H,3-4H2,1-2H3 |
| XLogP | 5.3000 |
| ExactMass | 348.9263 |
| MonoisotopicMass | 348.9263 |
| TPSA | 72.7000 |
| Complexity | 303.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 5 |
| RotatableBondCount | 6 |
| HeavyAtomCount | 18 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 52468 |
| PatentFamilyCount | 14972 |
| LiteratureCount | 11170 |