| 1 | 4-Chloro-2-methylaniline |
| 2 | 4-CHLORO-O-TOLUIDINE |
| 3 | 2-Amino-5-chlorotoluene |
| 4 | p-Chloro-o-toluidine |
| 5 | Fast Red TR Base |
p-Chloro-o-toluidine can cause cancer according to The World Health Organization's International Agency for Research on Cancer (IARC) and The Environmental Protection Agency (EPA).
| Molecular Formula | C7H8ClN |
|---|---|
| Canonical SMILES | CC1=C(C=CC(=C1)Cl)N |
| Isomeric SMILES | CC1=C(C=CC(=C1)Cl)N |
| Molecular Weight | 141.6000 |
| InChIKey | CXNVOWPRHWWCQR-UHFFFAOYSA-N |
| InChI | InChI=1S/C7H8ClN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
| XLogP | 1.9000 |
| ExactMass | 141.0345 |
| MonoisotopicMass | 141.0345 |
| TPSA | 26.0000 |
| Complexity | 94.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 1 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 9 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 4196 |
| PatentFamilyCount | 1966 |
| LiteratureCount | 247 |