| 1 | ANTHRACENE |
| 2 | Paranaphthalene |
| 3 | Anthracin |
| 4 | Tetra Olive N2G |
| 5 | Anthracen |
Anthracene can cause cancer according to California Labor Code and the World Health Organization's International Agency for Research on Cancer (IARC).
| Molecular Formula | C14H10 |
|---|---|
| Canonical SMILES | C1=CC=C2C=C3C=CC=CC3=CC2=C1 |
| Isomeric SMILES | C1=CC=C2C=C3C=CC=CC3=CC2=C1 |
| Molecular Weight | 178.2300 |
| InChIKey | MWPLVEDNUUSJAV-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H |
| XLogP | 4.4000 |
| ExactMass | 178.0783 |
| MonoisotopicMass | 178.0783 |
| TPSA | 0.0000 |
| Complexity | 154.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 0 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 14 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 32643 |
| PatentFamilyCount | 17477 |
| LiteratureCount | 21898 |