| 1 | AMPHETAMINE |
| 2 | Amfetamine |
| 3 | 1-phenylpropan-2-amine |
| 4 | dl-Amphetamine |
| 5 | Desoxynorephedrine |
1-phenylpropan-2-amine is a primary amine that is isopropylamine in which a hydrogen attached to one of the methyl groups has been replaced by a phenyl group.
| Molecular Formula | C9H13N |
|---|---|
| Canonical SMILES | CC(CC1=CC=CC=C1)N |
| Isomeric SMILES | CC(CC1=CC=CC=C1)N |
| Molecular Weight | 135.2100 |
| InChIKey | KWTSXDURSIMDCE-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3 |
| XLogP | 1.8000 |
| ExactMass | 135.1048 |
| MonoisotopicMass | 135.1048 |
| TPSA | 26.0000 |
| Complexity | 84.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 1 |
| RotatableBondCount | 2 |
| HeavyAtomCount | 10 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 1 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 54493 |
| PatentFamilyCount | 16677 |
| LiteratureCount | 37733 |