| 1 | AMITRAZ |
| 2 | Mitac |
| 3 | Taktic |
| 4 | Triazid |
| 5 | Azaform |
Amitraz can cause developmental toxicity according to The Environmental Protection Agency (EPA).
| Molecular Formula | C19H23N3 |
|---|---|
| Canonical SMILES | CC1=CC(=C(C=C1)N=CN(C)C=NC2=C(C=C(C=C2)C)C)C |
| Isomeric SMILES | CC1=CC(=C(C=C1)N=CN(C)C=NC2=C(C=C(C=C2)C)C)C |
| Molecular Weight | 293.4000 |
| InChIKey | QXAITBQSYVNQDR-UHFFFAOYSA-N |
| InChI | InChI=1S/C19H23N3/c1-14-6-8-18(16(3)10-14)20-12-22(5)13-21-19-9-7-15(2)11-17(19)4/h6-13H,1-5H3 |
| XLogP | 5.5000 |
| ExactMass | 293.1892 |
| MonoisotopicMass | 293.1892 |
| TPSA | 28.0000 |
| Complexity | 354.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 4 |
| HeavyAtomCount | 22 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 39905 |
| PatentFamilyCount | 9692 |
| LiteratureCount | 1510 |