| 1 | ACENAPHTHENE |
| 2 | 1,2-Dihydroacenaphthylene |
| 3 | 1,8-Ethylenenaphthalene |
| 4 | peri-Ethylenenaphthalene |
| 5 | Naphthyleneethylene |
Acenaphthene is a polycyclic aromatic hydrocarbon derived from naphthalene by the addition of an ethylene bridge connecting C-1 and C-8.
| Molecular Formula | C12H10 |
|---|---|
| Canonical SMILES | C1CC2=CC=CC3=C2C1=CC=C3 |
| Isomeric SMILES | C1CC2=CC=CC3=C2C1=CC=C3 |
| Molecular Weight | 154.2100 |
| InChIKey | CWRYPZZKDGJXCA-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2 |
| XLogP | 3.9000 |
| ExactMass | 154.0783 |
| MonoisotopicMass | 154.0783 |
| TPSA | 0.0000 |
| Complexity | 155.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 0 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 12 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 19821 |
| PatentFamilyCount | 8656 |
| LiteratureCount | 4427 |